C10H10F3NO3 — CID 91391069
2-[hydroxy(methoxy)methyl]-4-(trifluoromethyl)benzamide (PubChem CID 91391069) has the molecular formula C10H10F3NO3 and a molecular weight of 249.19 g/mol. Its IUPAC name is 2-[hydroxy(methoxy)methyl]-4-(trifluoromethyl)benzamide.
| Compound Name | 2-[hydroxy(methoxy)methyl]-4-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 91391069 |
| Molecular Formula | C10H10F3NO3 |
| Molecular Weight | 249.19 g/mol |
| Exact Mass | 249.06 |
| IUPAC Name | 2-[hydroxy(methoxy)methyl]-4-(trifluoromethyl)benzamide |
| SMILES | COC(O)c1cc(C(F)(F)F)ccc1C(N)=O |
| InChI | InChI=1S/C10H10F3NO3/c1-17-9(16)7-4-5(10(11,12)13)2-3-6(7)8(14)15/h2-4,9,16H,1H3,(H2,14,15) |
| InChIKey | OGHCKCLUPDCBNT-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.19 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|