C10H8ClF3O3 — CID 117424988
methyl 2-[2-chloro-5-(trifluoromethyl)phenyl]-2-hydroxyacetate (PubChem CID 117424988) has the molecular formula C10H8ClF3O3 and a molecular weight of 268.62 g/mol. Its IUPAC name is methyl 2-[2-chloro-5-(trifluoromethyl)phenyl]-2-hydroxyacetate.
| Compound Name | methyl 2-[2-chloro-5-(trifluoromethyl)phenyl]-2-hydroxyacetate |
|---|---|
| PubChem CID | 117424988 |
| Molecular Formula | C10H8ClF3O3 |
| Molecular Weight | 268.62 g/mol |
| Exact Mass | 268.01 |
| IUPAC Name | methyl 2-[2-chloro-5-(trifluoromethyl)phenyl]-2-hydroxyacetate |
| SMILES | COC(=O)C(O)c1cc(C(F)(F)F)ccc1Cl |
| InChI | InChI=1S/C10H8ClF3O3/c1-17-9(16)8(15)6-4-5(10(12,13)14)2-3-7(6)11/h2-4,8,15H,1H3 |
| InChIKey | UMSQHNDPPUTJJU-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.62 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |