C15H10ClF3O3 — CID 118813097
2-[2-chloro-5-[4-(trifluoromethyl)phenyl]phenyl]-2-hydroxyacetic acid (PubChem CID 118813097) has the molecular formula C15H10ClF3O3 and a molecular weight of 330.69 g/mol. Its IUPAC name is 2-[2-chloro-5-[4-(trifluoromethyl)phenyl]phenyl]-2-hydroxyacetic acid.
| Compound Name | 2-[2-chloro-5-[4-(trifluoromethyl)phenyl]phenyl]-2-hydroxyacetic acid |
|---|---|
| PubChem CID | 118813097 |
| Molecular Formula | C15H10ClF3O3 |
| Molecular Weight | 330.69 g/mol |
| Exact Mass | 330.03 |
| IUPAC Name | 2-[2-chloro-5-[4-(trifluoromethyl)phenyl]phenyl]-2-hydroxyacetic acid |
| SMILES | O=C(O)C(O)c1cc(-c2ccc(C(F)(F)F)cc2)ccc1Cl |
| InChI | InChI=1S/C15H10ClF3O3/c16-12-6-3-9(7-11(12)13(20)14(21)22)8-1-4-10(5-2-8)15(17,18)19/h1-7,13,20H,(H,21,22) |
| InChIKey | XQBVRYDOAAZCQM-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.69 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |