2-[2-(3,4-dichlorophenyl)-5-fluorophenyl]-2-hydroxyacetic acid

C14H9Cl2FO3 — CID 134633823

IUPAC2-[2-(3,4-dichlorophenyl)-5-fluorophenyl]-2-hydroxyacetic acid
SMILESO=C(O)C(O)c1cc(F)ccc1-c1ccc(Cl)c(Cl)c1
InChIInChI=1S/C14H9Cl2FO3/c15-11-4-1-7(5-12(11)16)9-3-2-8(17)6-10(9)13(18)14(19)20/h1-6,13,18H,(H,19,20)
InChIKeyJZGNZGUCIBMXSB-UHFFFAOYSA-N
MW315.13 g/mol
LogP3.92
Rot. Bonds3

About 2-[2-(3,4-dichlorophenyl)-5-fluorophenyl]-2-hydroxyacetic acid

2-[2-(3,4-dichlorophenyl)-5-fluorophenyl]-2-hydroxyacetic acid (PubChem CID 134633823) has the molecular formula C14H9Cl2FO3 and a molecular weight of 315.13 g/mol. Its IUPAC name is 2-[2-(3,4-dichlorophenyl)-5-fluorophenyl]-2-hydroxyacetic acid.

Molecular Properties

Compound Name2-[2-(3,4-dichlorophenyl)-5-fluorophenyl]-2-hydroxyacetic acid
PubChem CID134633823
Molecular FormulaC14H9Cl2FO3
Molecular Weight315.13 g/mol
Exact Mass313.99
IUPAC Name2-[2-(3,4-dichlorophenyl)-5-fluorophenyl]-2-hydroxyacetic acid
SMILESO=C(O)C(O)c1cc(F)ccc1-c1ccc(Cl)c(Cl)c1
InChIInChI=1S/C14H9Cl2FO3/c15-11-4-1-7(5-12(11)16)9-3-2-8(17)6-10(9)13(18)14(19)20/h1-6,13,18H,(H,19,20)
InChIKeyJZGNZGUCIBMXSB-UHFFFAOYSA-N
XLogP3.92
TPSA57.53 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds3
Heavy Atoms20
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500315.13
LogP ≤ 53.92
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Analyze 2-[2-(3,4-dichlorophenyl)-5-fluorophenyl]-2-hydroxyacetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[2-(3,4-dichlorophenyl)-5-fluorophenyl]-2-hydroxyacetic acid?
The IUPAC name of 2-[2-(3,4-dichlorophenyl)-5-fluorophenyl]-2-hydroxyacetic acid (CID 134633823) is 2-[2-(3,4-dichlorophenyl)-5-fluorophenyl]-2-hydroxyacetic acid.
What is the SMILES notation for 2-[2-(3,4-dichlorophenyl)-5-fluorophenyl]-2-hydroxyacetic acid?
The canonical SMILES for 2-[2-(3,4-dichlorophenyl)-5-fluorophenyl]-2-hydroxyacetic acid is O=C(O)C(O)c1cc(F)ccc1-c1ccc(Cl)c(Cl)c1.
What is the InChIKey of 2-[2-(3,4-dichlorophenyl)-5-fluorophenyl]-2-hydroxyacetic acid?
The InChIKey is JZGNZGUCIBMXSB-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H9Cl2FO3/c15-11-4-1-7(5-12(11)16)9-3-2-8(17)6-10(9)13(18)14(19)20/h1-6,13,18H,(H,19,20).
What are the key properties of 2-[2-(3,4-dichlorophenyl)-5-fluorophenyl]-2-hydroxyacetic acid?
2-[2-(3,4-dichlorophenyl)-5-fluorophenyl]-2-hydroxyacetic acid has a molecular weight of 315.13 g/mol, XLogP of 3.92, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-(3,4-dichlorophenyl)-5-fluorophenyl]-2-hydroxyacetic acid is sourced from PubChem (CID 134633823), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).