C8H7FO4 — CID 117280331
2-(4-fluoro-2-hydroxyphenyl)-2-hydroxyacetic acid (PubChem CID 117280331) has the molecular formula C8H7FO4 and a molecular weight of 186.14 g/mol. Its IUPAC name is 2-(4-fluoro-2-hydroxyphenyl)-2-hydroxyacetic acid.
| Compound Name | 2-(4-fluoro-2-hydroxyphenyl)-2-hydroxyacetic acid |
|---|---|
| PubChem CID | 117280331 |
| Molecular Formula | C8H7FO4 |
| Molecular Weight | 186.14 g/mol |
| Exact Mass | 186.03 |
| IUPAC Name | 2-(4-fluoro-2-hydroxyphenyl)-2-hydroxyacetic acid |
| SMILES | O=C(O)C(O)c1ccc(F)cc1O |
| InChI | InChI=1S/C8H7FO4/c9-4-1-2-5(6(10)3-4)7(11)8(12)13/h1-3,7,10-11H,(H,12,13) |
| InChIKey | RLQPRCXFVYZJGR-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.14 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |