C11H11FO5 — CID 118841930
3-[2-[carboxy(hydroxy)methyl]-4-fluorophenyl]propanoic acid (PubChem CID 118841930) has the molecular formula C11H11FO5 and a molecular weight of 242.20 g/mol. Its IUPAC name is 3-[2-[carboxy(hydroxy)methyl]-4-fluorophenyl]propanoic acid.
| Compound Name | 3-[2-[carboxy(hydroxy)methyl]-4-fluorophenyl]propanoic acid |
|---|---|
| PubChem CID | 118841930 |
| Molecular Formula | C11H11FO5 |
| Molecular Weight | 242.20 g/mol |
| Exact Mass | 242.06 |
| IUPAC Name | 3-[2-[carboxy(hydroxy)methyl]-4-fluorophenyl]propanoic acid |
| SMILES | O=C(O)CCc1ccc(F)cc1C(O)C(=O)O |
| InChI | InChI=1S/C11H11FO5/c12-7-3-1-6(2-4-9(13)14)8(5-7)10(15)11(16)17/h1,3,5,10,15H,2,4H2,(H,13,14)(H,16,17) |
| InChIKey | CWIFQRYGOXAEGK-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 94.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.20 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |