C12H12F2O5 — CID 134656647
3-[4-[carboxy(hydroxy)methyl]-3-(difluoromethyl)phenyl]propanoic acid (PubChem CID 134656647) has the molecular formula C12H12F2O5 and a molecular weight of 274.22 g/mol. Its IUPAC name is 3-[4-[carboxy(hydroxy)methyl]-3-(difluoromethyl)phenyl]propanoic acid.
| Compound Name | 3-[4-[carboxy(hydroxy)methyl]-3-(difluoromethyl)phenyl]propanoic acid |
|---|---|
| PubChem CID | 134656647 |
| Molecular Formula | C12H12F2O5 |
| Molecular Weight | 274.22 g/mol |
| Exact Mass | 274.07 |
| IUPAC Name | 3-[4-[carboxy(hydroxy)methyl]-3-(difluoromethyl)phenyl]propanoic acid |
| SMILES | O=C(O)CCc1ccc(C(O)C(=O)O)c(C(F)F)c1 |
| InChI | InChI=1S/C12H12F2O5/c13-11(14)8-5-6(2-4-9(15)16)1-3-7(8)10(17)12(18)19/h1,3,5,10-11,17H,2,4H2,(H,15,16)(H,18,19) |
| InChIKey | YEZHKEWFRLKKEX-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 94.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.22 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |