C12H12F2O6 — CID 134656553
3-[4-[carboxy(hydroxy)methyl]-3-(difluoromethoxy)phenyl]propanoic acid (PubChem CID 134656553) has the molecular formula C12H12F2O6 and a molecular weight of 290.22 g/mol. Its IUPAC name is 3-[4-[carboxy(hydroxy)methyl]-3-(difluoromethoxy)phenyl]propanoic acid.
| Compound Name | 3-[4-[carboxy(hydroxy)methyl]-3-(difluoromethoxy)phenyl]propanoic acid |
|---|---|
| PubChem CID | 134656553 |
| Molecular Formula | C12H12F2O6 |
| Molecular Weight | 290.22 g/mol |
| Exact Mass | 290.06 |
| IUPAC Name | 3-[4-[carboxy(hydroxy)methyl]-3-(difluoromethoxy)phenyl]propanoic acid |
| SMILES | O=C(O)CCc1ccc(C(O)C(=O)O)c(OC(F)F)c1 |
| InChI | InChI=1S/C12H12F2O6/c13-12(14)20-8-5-6(2-4-9(15)16)1-3-7(8)10(17)11(18)19/h1,3,5,10,12,17H,2,4H2,(H,15,16)(H,18,19) |
| InChIKey | XRDXSDZHCBKGHI-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 104.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.22 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |