C12H13BrF2O4 — CID 134656570
2-[4-(3-bromopropyl)-2-(difluoromethoxy)phenyl]-2-hydroxyacetic acid (PubChem CID 134656570) has the molecular formula C12H13BrF2O4 and a molecular weight of 339.13 g/mol. Its IUPAC name is 2-[4-(3-bromopropyl)-2-(difluoromethoxy)phenyl]-2-hydroxyacetic acid.
| Compound Name | 2-[4-(3-bromopropyl)-2-(difluoromethoxy)phenyl]-2-hydroxyacetic acid |
|---|---|
| PubChem CID | 134656570 |
| Molecular Formula | C12H13BrF2O4 |
| Molecular Weight | 339.13 g/mol |
| Exact Mass | 338.00 |
| IUPAC Name | 2-[4-(3-bromopropyl)-2-(difluoromethoxy)phenyl]-2-hydroxyacetic acid |
| SMILES | O=C(O)C(O)c1ccc(CCCBr)cc1OC(F)F |
| InChI | InChI=1S/C12H13BrF2O4/c13-5-1-2-7-3-4-8(10(16)11(17)18)9(6-7)19-12(14)15/h3-4,6,10,12,16H,1-2,5H2,(H,17,18) |
| InChIKey | WBXWEIIQYJWXDY-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.13 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|