C9H8Br2O3 — CID 118990978
2-[2-bromo-4-(bromomethyl)phenyl]-2-hydroxyacetic acid (PubChem CID 118990978) has the molecular formula C9H8Br2O3 and a molecular weight of 323.97 g/mol. Its IUPAC name is 2-[2-bromo-4-(bromomethyl)phenyl]-2-hydroxyacetic acid.
| Compound Name | 2-[2-bromo-4-(bromomethyl)phenyl]-2-hydroxyacetic acid |
|---|---|
| PubChem CID | 118990978 |
| Molecular Formula | C9H8Br2O3 |
| Molecular Weight | 323.97 g/mol |
| Exact Mass | 321.88 |
| IUPAC Name | 2-[2-bromo-4-(bromomethyl)phenyl]-2-hydroxyacetic acid |
| SMILES | O=C(O)C(O)c1ccc(CBr)cc1Br |
| InChI | InChI=1S/C9H8Br2O3/c10-4-5-1-2-6(7(11)3-5)8(12)9(13)14/h1-3,8,12H,4H2,(H,13,14) |
| InChIKey | BBSRQWUTOHFNMY-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.97 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|