C10H11BrO3 — CID 84806104
2-[2-bromo-4-(hydroxymethyl)phenyl]propanoic acid (PubChem CID 84806104) has the molecular formula C10H11BrO3 and a molecular weight of 259.10 g/mol. Its IUPAC name is 2-[2-bromo-4-(hydroxymethyl)phenyl]propanoic acid.
| Compound Name | 2-[2-bromo-4-(hydroxymethyl)phenyl]propanoic acid |
|---|---|
| PubChem CID | 84806104 |
| Molecular Formula | C10H11BrO3 |
| Molecular Weight | 259.10 g/mol |
| Exact Mass | 257.99 |
| IUPAC Name | 2-[2-bromo-4-(hydroxymethyl)phenyl]propanoic acid |
| SMILES | CC(C(=O)O)c1ccc(CO)cc1Br |
| InChI | InChI=1S/C10H11BrO3/c1-6(10(13)14)8-3-2-7(5-12)4-9(8)11/h2-4,6,12H,5H2,1H3,(H,13,14) |
| InChIKey | ZTKVPOJZLPGZLE-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.10 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |