C15H21BrO2 — CID 117498569
3-(3-bromo-4-butan-2-ylphenyl)-2,2-dimethylpropanoic acid (PubChem CID 117498569) has the molecular formula C15H21BrO2 and a molecular weight of 313.24 g/mol. Its IUPAC name is 3-(3-bromo-4-butan-2-ylphenyl)-2,2-dimethylpropanoic acid.
| Compound Name | 3-(3-bromo-4-butan-2-ylphenyl)-2,2-dimethylpropanoic acid |
|---|---|
| PubChem CID | 117498569 |
| Molecular Formula | C15H21BrO2 |
| Molecular Weight | 313.24 g/mol |
| Exact Mass | 312.07 |
| IUPAC Name | 3-(3-bromo-4-butan-2-ylphenyl)-2,2-dimethylpropanoic acid |
| SMILES | CCC(C)c1ccc(CC(C)(C)C(=O)O)cc1Br |
| InChI | InChI=1S/C15H21BrO2/c1-5-10(2)12-7-6-11(8-13(12)16)9-15(3,4)14(17)18/h6-8,10H,5,9H2,1-4H3,(H,17,18) |
| InChIKey | MUAIBQODFBQBSW-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.24 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |