About 3-[3-bromo-4-(fluoromethyl)phenyl]-2,2-dimethylpropanoic acid
3-[3-bromo-4-(fluoromethyl)phenyl]-2,2-dimethylpropanoic acid (PubChem CID 117466889) has the molecular formula C12H14BrFO2
and a molecular weight of 289.14 g/mol. Its IUPAC name is 3-[3-bromo-4-(fluoromethyl)phenyl]-2,2-dimethylpropanoic acid.
Analyze 3-[3-bromo-4-(fluoromethyl)phenyl]-2,2-dimethylpropanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[3-bromo-4-(fluoromethyl)phenyl]-2,2-dimethylpropanoic acid?
The IUPAC name of 3-[3-bromo-4-(fluoromethyl)phenyl]-2,2-dimethylpropanoic acid (CID 117466889) is 3-[3-bromo-4-(fluoromethyl)phenyl]-2,2-dimethylpropanoic acid.
What is the SMILES notation for 3-[3-bromo-4-(fluoromethyl)phenyl]-2,2-dimethylpropanoic acid?
The canonical SMILES for 3-[3-bromo-4-(fluoromethyl)phenyl]-2,2-dimethylpropanoic acid is CC(C)(Cc1ccc(CF)c(Br)c1)C(=O)O.
What is the InChIKey of 3-[3-bromo-4-(fluoromethyl)phenyl]-2,2-dimethylpropanoic acid?
The InChIKey is ZOJHRNKMMQACDZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14BrFO2/c1-12(2,11(15)16)6-8-3-4-9(7-14)10(13)5-8/h3-5H,6-7H2,1-2H3,(H,15,16).
What are the key properties of 3-[3-bromo-4-(fluoromethyl)phenyl]-2,2-dimethylpropanoic acid?
3-[3-bromo-4-(fluoromethyl)phenyl]-2,2-dimethylpropanoic acid has a molecular weight of 289.14 g/mol, XLogP of 3.57, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[3-bromo-4-(fluoromethyl)phenyl]-2,2-dimethylpropanoic acid is sourced from PubChem (CID 117466889), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).