C12H14BrFO2 — CID 117275044
methyl 3-(3-bromo-4-fluorophenyl)-2,2-dimethylpropanoate (PubChem CID 117275044) has the molecular formula C12H14BrFO2 and a molecular weight of 289.14 g/mol. Its IUPAC name is methyl 3-(3-bromo-4-fluorophenyl)-2,2-dimethylpropanoate.
| Compound Name | methyl 3-(3-bromo-4-fluorophenyl)-2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 117275044 |
| Molecular Formula | C12H14BrFO2 |
| Molecular Weight | 289.14 g/mol |
| Exact Mass | 288.02 |
| IUPAC Name | methyl 3-(3-bromo-4-fluorophenyl)-2,2-dimethylpropanoate |
| SMILES | COC(=O)C(C)(C)Cc1ccc(F)c(Br)c1 |
| InChI | InChI=1S/C12H14BrFO2/c1-12(2,11(15)16-3)7-8-4-5-10(14)9(13)6-8/h4-6H,7H2,1-3H3 |
| InChIKey | QABPZFWHJDBYHI-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.14 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |