C10H11BrFNO2 — CID 68768500
methyl (2S)-2-amino-3-(3-bromo-4-fluorophenyl)propanoate (PubChem CID 68768500) has the molecular formula C10H11BrFNO2 and a molecular weight of 276.11 g/mol. Its IUPAC name is methyl (2S)-2-amino-3-(3-bromo-4-fluorophenyl)propanoate.
| Compound Name | methyl (2S)-2-amino-3-(3-bromo-4-fluorophenyl)propanoate |
|---|---|
| PubChem CID | 68768500 |
| Molecular Formula | C10H11BrFNO2 |
| Molecular Weight | 276.11 g/mol |
| Exact Mass | 275.00 |
| IUPAC Name | methyl (2S)-2-amino-3-(3-bromo-4-fluorophenyl)propanoate |
| SMILES | COC(=O)[C@@H](N)Cc1ccc(F)c(Br)c1 |
| InChI | InChI=1S/C10H11BrFNO2/c1-15-10(14)9(13)5-6-2-3-8(12)7(11)4-6/h2-4,9H,5,13H2,1H3/t9-/m0/s1 |
| InChIKey | VYABIKSVSBZGAS-VIFPVBQESA-N |
| XLogP | 1.63 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.11 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |