C10H11BrFNO3 — CID 170884169
methyl 2-amino-3-(5-bromo-4-fluoro-2-hydroxyphenyl)propanoate (PubChem CID 170884169) has the molecular formula C10H11BrFNO3 and a molecular weight of 292.10 g/mol. Its IUPAC name is methyl 2-amino-3-(5-bromo-4-fluoro-2-hydroxyphenyl)propanoate.
| Compound Name | methyl 2-amino-3-(5-bromo-4-fluoro-2-hydroxyphenyl)propanoate |
|---|---|
| PubChem CID | 170884169 |
| Molecular Formula | C10H11BrFNO3 |
| Molecular Weight | 292.10 g/mol |
| Exact Mass | 290.99 |
| IUPAC Name | methyl 2-amino-3-(5-bromo-4-fluoro-2-hydroxyphenyl)propanoate |
| SMILES | COC(=O)C(N)Cc1cc(Br)c(F)cc1O |
| InChI | InChI=1S/C10H11BrFNO3/c1-16-10(15)8(13)3-5-2-6(11)7(12)4-9(5)14/h2,4,8,14H,3,13H2,1H3 |
| InChIKey | CDAYYOAQJKMKCW-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.10 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |