C10H12FNO3 — CID 77391788
methyl 2-amino-3-(4-fluoro-3-hydroxyphenyl)propanoate (PubChem CID 77391788) has the molecular formula C10H12FNO3 and a molecular weight of 213.21 g/mol. Its IUPAC name is methyl 2-amino-3-(4-fluoro-3-hydroxyphenyl)propanoate.
| Compound Name | methyl 2-amino-3-(4-fluoro-3-hydroxyphenyl)propanoate |
|---|---|
| PubChem CID | 77391788 |
| Molecular Formula | C10H12FNO3 |
| Molecular Weight | 213.21 g/mol |
| Exact Mass | 213.08 |
| IUPAC Name | methyl 2-amino-3-(4-fluoro-3-hydroxyphenyl)propanoate |
| SMILES | COC(=O)C(N)Cc1ccc(F)c(O)c1 |
| InChI | InChI=1S/C10H12FNO3/c1-15-10(14)8(12)4-6-2-3-7(11)9(13)5-6/h2-3,5,8,13H,4,12H2,1H3 |
| InChIKey | JZDZDMWGBOZZSP-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.21 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |