C10H14N2O3 — CID 86019498
methyl 2-amino-3-(3-amino-4-hydroxyphenyl)propanoate (PubChem CID 86019498) has the molecular formula C10H14N2O3 and a molecular weight of 210.23 g/mol. Its IUPAC name is methyl 2-amino-3-(3-amino-4-hydroxyphenyl)propanoate.
| Compound Name | methyl 2-amino-3-(3-amino-4-hydroxyphenyl)propanoate |
|---|---|
| PubChem CID | 86019498 |
| Molecular Formula | C10H14N2O3 |
| Molecular Weight | 210.23 g/mol |
| Exact Mass | 210.10 |
| IUPAC Name | methyl 2-amino-3-(3-amino-4-hydroxyphenyl)propanoate |
| SMILES | COC(=O)C(N)Cc1ccc(O)c(N)c1 |
| InChI | InChI=1S/C10H14N2O3/c1-15-10(14)8(12)5-6-2-3-9(13)7(11)4-6/h2-4,8,13H,5,11-12H2,1H3 |
| InChIKey | KZGGIOWCNWQXAZ-UHFFFAOYSA-N |
| XLogP | 0.02 |
| TPSA | 98.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.23 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|