C18H22N4O5 — CID 91296198
(2S)-2-amino-3-[3-amino-4-[(2S)-2-amino-3-(3-amino-4-hydroxyphenyl)propanoyl]oxyphenyl]propanoic acid (PubChem CID 91296198) has the molecular formula C18H22N4O5 and a molecular weight of 374.40 g/mol. Its IUPAC name is (2S)-2-amino-3-[3-amino-4-[(2S)-2-amino-3-(3-amino-4-hydroxyphenyl)propanoyl]oxyphenyl]propanoic acid.
| Compound Name | (2S)-2-amino-3-[3-amino-4-[(2S)-2-amino-3-(3-amino-4-hydroxyphenyl)propanoyl]oxyphenyl]propanoic acid |
|---|---|
| PubChem CID | 91296198 |
| Molecular Formula | C18H22N4O5 |
| Molecular Weight | 374.40 g/mol |
| Exact Mass | 374.16 |
| IUPAC Name | (2S)-2-amino-3-[3-amino-4-[(2S)-2-amino-3-(3-amino-4-hydroxyphenyl)propanoyl]oxyphenyl]propanoic acid |
| SMILES | Nc1cc(C[C@H](N)C(=O)Oc2ccc(C[C@H](N)C(=O)O)cc2N)ccc1O |
| InChI | InChI=1S/C18H22N4O5/c19-11-5-9(1-3-15(11)23)8-14(22)18(26)27-16-4-2-10(6-12(16)20)7-13(21)17(24)25/h1-6,13-14,23H,7-8,19-22H2,(H,24,25)/t13-,14-/m0/s1 |
| InChIKey | YONXVWFCIMFAHN-KBPBESRZSA-N |
| XLogP | -0.01 |
| TPSA | 187.91 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.40 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|