methyl (2R)-2-amino-3-(3,4-dimethylphenyl)propanoate

C12H17NO2 — CID 145416225

IUPACmethyl (2R)-2-amino-3-(3,4-dimethylphenyl)propanoate
SMILESCOC(=O)[C@H](N)Cc1ccc(C)c(C)c1
InChIInChI=1S/C12H17NO2/c1-8-4-5-10(6-9(8)2)7-11(13)12(14)15-3/h4-6,11H,7,13H2,1-3H3/t11-/m1/s1
InChIKeyLPJNTMUJZOQQED-LLVKDONJSA-N
MW207.27 g/mol
LogP1.35
Rot. Bonds3

About methyl (2R)-2-amino-3-(3,4-dimethylphenyl)propanoate

methyl (2R)-2-amino-3-(3,4-dimethylphenyl)propanoate (PubChem CID 145416225) has the molecular formula C12H17NO2 and a molecular weight of 207.27 g/mol. Its IUPAC name is methyl (2R)-2-amino-3-(3,4-dimethylphenyl)propanoate.

Molecular Properties

Compound Namemethyl (2R)-2-amino-3-(3,4-dimethylphenyl)propanoate
PubChem CID145416225
Molecular FormulaC12H17NO2
Molecular Weight207.27 g/mol
Exact Mass207.13
IUPAC Namemethyl (2R)-2-amino-3-(3,4-dimethylphenyl)propanoate
SMILESCOC(=O)[C@H](N)Cc1ccc(C)c(C)c1
InChIInChI=1S/C12H17NO2/c1-8-4-5-10(6-9(8)2)7-11(13)12(14)15-3/h4-6,11H,7,13H2,1-3H3/t11-/m1/s1
InChIKeyLPJNTMUJZOQQED-LLVKDONJSA-N
XLogP1.35
TPSA52.32 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms15
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500207.27
LogP ≤ 51.35
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze methyl (2R)-2-amino-3-(3,4-dimethylphenyl)propanoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl (2R)-2-amino-3-(3,4-dimethylphenyl)propanoate?
The IUPAC name of methyl (2R)-2-amino-3-(3,4-dimethylphenyl)propanoate (CID 145416225) is methyl (2R)-2-amino-3-(3,4-dimethylphenyl)propanoate.
What is the SMILES notation for methyl (2R)-2-amino-3-(3,4-dimethylphenyl)propanoate?
The canonical SMILES for methyl (2R)-2-amino-3-(3,4-dimethylphenyl)propanoate is COC(=O)[C@H](N)Cc1ccc(C)c(C)c1.
What is the InChIKey of methyl (2R)-2-amino-3-(3,4-dimethylphenyl)propanoate?
The InChIKey is LPJNTMUJZOQQED-LLVKDONJSA-N. The full InChI is InChI=1S/C12H17NO2/c1-8-4-5-10(6-9(8)2)7-11(13)12(14)15-3/h4-6,11H,7,13H2,1-3H3/t11-/m1/s1.
What are the key properties of methyl (2R)-2-amino-3-(3,4-dimethylphenyl)propanoate?
methyl (2R)-2-amino-3-(3,4-dimethylphenyl)propanoate has a molecular weight of 207.27 g/mol, XLogP of 1.35, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (2R)-2-amino-3-(3,4-dimethylphenyl)propanoate is sourced from PubChem (CID 145416225), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).