About methyl 2-amino-3-(3,4-dichlorophenyl)propanoate;hydrochloride
methyl 2-amino-3-(3,4-dichlorophenyl)propanoate;hydrochloride (PubChem CID 68772138) has the molecular formula C10H12Cl3NO2
and a molecular weight of 284.57 g/mol. Its IUPAC name is methyl 2-amino-3-(3,4-dichlorophenyl)propanoate;hydrochloride.
Analyze methyl 2-amino-3-(3,4-dichlorophenyl)propanoate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-amino-3-(3,4-dichlorophenyl)propanoate;hydrochloride?
The IUPAC name of methyl 2-amino-3-(3,4-dichlorophenyl)propanoate;hydrochloride (CID 68772138) is methyl 2-amino-3-(3,4-dichlorophenyl)propanoate;hydrochloride.
What is the SMILES notation for methyl 2-amino-3-(3,4-dichlorophenyl)propanoate;hydrochloride?
The canonical SMILES for methyl 2-amino-3-(3,4-dichlorophenyl)propanoate;hydrochloride is COC(=O)C(N)Cc1ccc(Cl)c(Cl)c1.Cl.
What is the InChIKey of methyl 2-amino-3-(3,4-dichlorophenyl)propanoate;hydrochloride?
The InChIKey is NOTFEHXAVUQWDQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11Cl2NO2.ClH/c1-15-10(14)9(13)5-6-2-3-7(11)8(12)4-6;/h2-4,9H,5,13H2,1H3;1H.
What are the key properties of methyl 2-amino-3-(3,4-dichlorophenyl)propanoate;hydrochloride?
methyl 2-amino-3-(3,4-dichlorophenyl)propanoate;hydrochloride has a molecular weight of 284.57 g/mol, XLogP of 2.46, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-amino-3-(3,4-dichlorophenyl)propanoate;hydrochloride is sourced from PubChem (CID 68772138), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).