C11H11ClF3NO2 — CID 171238216
methyl (2R)-2-amino-3-[3-chloro-4-(trifluoromethyl)phenyl]propanoate (PubChem CID 171238216) has the molecular formula C11H11ClF3NO2 and a molecular weight of 281.66 g/mol. Its IUPAC name is methyl (2R)-2-amino-3-[3-chloro-4-(trifluoromethyl)phenyl]propanoate.
| Compound Name | methyl (2R)-2-amino-3-[3-chloro-4-(trifluoromethyl)phenyl]propanoate |
|---|---|
| PubChem CID | 171238216 |
| Molecular Formula | C11H11ClF3NO2 |
| Molecular Weight | 281.66 g/mol |
| Exact Mass | 281.04 |
| IUPAC Name | methyl (2R)-2-amino-3-[3-chloro-4-(trifluoromethyl)phenyl]propanoate |
| SMILES | COC(=O)[C@H](N)Cc1ccc(C(F)(F)F)c(Cl)c1 |
| InChI | InChI=1S/C11H11ClF3NO2/c1-18-10(17)9(16)5-6-2-3-7(8(12)4-6)11(13,14)15/h2-4,9H,5,16H2,1H3/t9-/m1/s1 |
| InChIKey | FMQHHHBMLSWAHJ-SECBINFHSA-N |
| XLogP | 2.40 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.66 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |