C11H12ClNO4 — CID 171238463
4-[(2S)-2-amino-3-methoxy-3-oxopropyl]-2-chlorobenzoic acid (PubChem CID 171238463) has the molecular formula C11H12ClNO4 and a molecular weight of 257.67 g/mol. Its IUPAC name is 4-[(2S)-2-amino-3-methoxy-3-oxopropyl]-2-chlorobenzoic acid.
| Compound Name | 4-[(2S)-2-amino-3-methoxy-3-oxopropyl]-2-chlorobenzoic acid |
|---|---|
| PubChem CID | 171238463 |
| Molecular Formula | C11H12ClNO4 |
| Molecular Weight | 257.67 g/mol |
| Exact Mass | 257.05 |
| IUPAC Name | 4-[(2S)-2-amino-3-methoxy-3-oxopropyl]-2-chlorobenzoic acid |
| SMILES | COC(=O)[C@@H](N)Cc1ccc(C(=O)O)c(Cl)c1 |
| InChI | InChI=1S/C11H12ClNO4/c1-17-11(16)9(13)5-6-2-3-7(10(14)15)8(12)4-6/h2-4,9H,5,13H2,1H3,(H,14,15)/t9-/m0/s1 |
| InChIKey | UBEDMIXMFSBAJQ-VIFPVBQESA-N |
| XLogP | 1.08 |
| TPSA | 89.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.67 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |