C15H10Cl2O4 — CID 19980721
4-[(4-carboxy-3-chlorophenyl)methyl]-2-chlorobenzoic acid (PubChem CID 19980721) has the molecular formula C15H10Cl2O4 and a molecular weight of 325.15 g/mol. Its IUPAC name is 4-[(4-carboxy-3-chlorophenyl)methyl]-2-chlorobenzoic acid.
| Compound Name | 4-[(4-carboxy-3-chlorophenyl)methyl]-2-chlorobenzoic acid |
|---|---|
| PubChem CID | 19980721 |
| Molecular Formula | C15H10Cl2O4 |
| Molecular Weight | 325.15 g/mol |
| Exact Mass | 324.00 |
| IUPAC Name | 4-[(4-carboxy-3-chlorophenyl)methyl]-2-chlorobenzoic acid |
| SMILES | O=C(O)c1ccc(Cc2ccc(C(=O)O)c(Cl)c2)cc1Cl |
| InChI | InChI=1S/C15H10Cl2O4/c16-12-6-8(1-3-10(12)14(18)19)5-9-2-4-11(15(20)21)13(17)7-9/h1-4,6-7H,5H2,(H,18,19)(H,20,21) |
| InChIKey | VEVUINBKOWRIGD-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.15 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |