About 4-benzyl-2-chlorobenzoic acid
4-benzyl-2-chlorobenzoic acid (PubChem CID 150746352) has the molecular formula C14H11ClO2
and a molecular weight of 246.69 g/mol. Its IUPAC name is 4-benzyl-2-chlorobenzoic acid.
Molecular Properties
| Compound Name | 4-benzyl-2-chlorobenzoic acid |
| PubChem CID | 150746352 |
| Molecular Formula | C14H11ClO2 |
| Molecular Weight | 246.69 g/mol |
| Exact Mass | 246.04 |
| IUPAC Name | 4-benzyl-2-chlorobenzoic acid |
| SMILES | O=C(O)c1ccc(Cc2ccccc2)cc1Cl |
| InChI | InChI=1S/C14H11ClO2/c15-13-9-11(6-7-12(13)14(16)17)8-10-4-2-1-3-5-10/h1-7,9H,8H2,(H,16,17) |
| InChIKey | JUXULYQTYYKHNG-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.69 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-benzyl-2-chlorobenzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-benzyl-2-chlorobenzoic acid?
The IUPAC name of 4-benzyl-2-chlorobenzoic acid (CID 150746352) is 4-benzyl-2-chlorobenzoic acid.
What is the SMILES notation for 4-benzyl-2-chlorobenzoic acid?
The canonical SMILES for 4-benzyl-2-chlorobenzoic acid is O=C(O)c1ccc(Cc2ccccc2)cc1Cl.
What is the InChIKey of 4-benzyl-2-chlorobenzoic acid?
The InChIKey is JUXULYQTYYKHNG-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H11ClO2/c15-13-9-11(6-7-12(13)14(16)17)8-10-4-2-1-3-5-10/h1-7,9H,8H2,(H,16,17).
What are the key properties of 4-benzyl-2-chlorobenzoic acid?
4-benzyl-2-chlorobenzoic acid has a molecular weight of 246.69 g/mol, XLogP of 3.63, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-benzyl-2-chlorobenzoic acid is sourced from PubChem (CID 150746352), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).