About 2-amino-5-benzylbenzoic acid
2-amino-5-benzylbenzoic acid (PubChem CID 23538086) has the molecular formula C14H13NO2
and a molecular weight of 227.26 g/mol. Its IUPAC name is 2-amino-5-benzylbenzoic acid.
Molecular Properties
| Compound Name | 2-amino-5-benzylbenzoic acid |
| PubChem CID | 23538086 |
| Molecular Formula | C14H13NO2 |
| Molecular Weight | 227.26 g/mol |
| Exact Mass | 227.09 |
| IUPAC Name | 2-amino-5-benzylbenzoic acid |
| SMILES | Nc1ccc(Cc2ccccc2)cc1C(=O)O |
| InChI | InChI=1S/C14H13NO2/c15-13-7-6-11(9-12(13)14(16)17)8-10-4-2-1-3-5-10/h1-7,9H,8,15H2,(H,16,17) |
| InChIKey | CKRCMQDNWIAUAZ-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.26 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2-amino-5-benzylbenzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-5-benzylbenzoic acid?
The IUPAC name of 2-amino-5-benzylbenzoic acid (CID 23538086) is 2-amino-5-benzylbenzoic acid.
What is the SMILES notation for 2-amino-5-benzylbenzoic acid?
The canonical SMILES for 2-amino-5-benzylbenzoic acid is Nc1ccc(Cc2ccccc2)cc1C(=O)O.
What is the InChIKey of 2-amino-5-benzylbenzoic acid?
The InChIKey is CKRCMQDNWIAUAZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H13NO2/c15-13-7-6-11(9-12(13)14(16)17)8-10-4-2-1-3-5-10/h1-7,9H,8,15H2,(H,16,17).
What are the key properties of 2-amino-5-benzylbenzoic acid?
2-amino-5-benzylbenzoic acid has a molecular weight of 227.26 g/mol, XLogP of 2.56, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-5-benzylbenzoic acid is sourced from PubChem (CID 23538086), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).