About 5-benzyl-2-chloroaniline
5-benzyl-2-chloroaniline (PubChem CID 39243776) has the molecular formula C13H12ClN
and a molecular weight of 217.70 g/mol. Its IUPAC name is 5-benzyl-2-chloroaniline.
Molecular Properties
| Compound Name | 5-benzyl-2-chloroaniline |
| PubChem CID | 39243776 |
| Molecular Formula | C13H12ClN |
| Molecular Weight | 217.70 g/mol |
| Exact Mass | 217.07 |
| IUPAC Name | 5-benzyl-2-chloroaniline |
| SMILES | Nc1cc(Cc2ccccc2)ccc1Cl |
| InChI | InChI=1S/C13H12ClN/c14-12-7-6-11(9-13(12)15)8-10-4-2-1-3-5-10/h1-7,9H,8,15H2 |
| InChIKey | BQJNHFAKSGKIAT-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 217.70 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 5-benzyl-2-chloroaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-benzyl-2-chloroaniline?
The IUPAC name of 5-benzyl-2-chloroaniline (CID 39243776) is 5-benzyl-2-chloroaniline.
What is the SMILES notation for 5-benzyl-2-chloroaniline?
The canonical SMILES for 5-benzyl-2-chloroaniline is Nc1cc(Cc2ccccc2)ccc1Cl.
What is the InChIKey of 5-benzyl-2-chloroaniline?
The InChIKey is BQJNHFAKSGKIAT-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12ClN/c14-12-7-6-11(9-13(12)15)8-10-4-2-1-3-5-10/h1-7,9H,8,15H2.
What are the key properties of 5-benzyl-2-chloroaniline?
5-benzyl-2-chloroaniline has a molecular weight of 217.70 g/mol, XLogP of 3.51, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-benzyl-2-chloroaniline is sourced from PubChem (CID 39243776), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).