C27H22N2O6 — CID 18381152
2-(4-aminophenoxy)-5-[[4-(4-aminophenoxy)-3-carboxyphenyl]methyl]benzoic acid (PubChem CID 18381152) has the molecular formula C27H22N2O6 and a molecular weight of 470.48 g/mol. Its IUPAC name is 2-(4-aminophenoxy)-5-[[4-(4-aminophenoxy)-3-carboxyphenyl]methyl]benzoic acid.
| Compound Name | 2-(4-aminophenoxy)-5-[[4-(4-aminophenoxy)-3-carboxyphenyl]methyl]benzoic acid |
|---|---|
| PubChem CID | 18381152 |
| Molecular Formula | C27H22N2O6 |
| Molecular Weight | 470.48 g/mol |
| Exact Mass | 470.15 |
| IUPAC Name | 2-(4-aminophenoxy)-5-[[4-(4-aminophenoxy)-3-carboxyphenyl]methyl]benzoic acid |
| SMILES | Nc1ccc(Oc2ccc(Cc3ccc(Oc4ccc(N)cc4)c(C(=O)O)c3)cc2C(=O)O)cc1 |
| InChI | InChI=1S/C27H22N2O6/c28-18-3-7-20(8-4-18)34-24-11-1-16(14-22(24)26(30)31)13-17-2-12-25(23(15-17)27(32)33)35-21-9-5-19(29)6-10-21/h1-12,14-15H,13,28-29H2,(H,30,31)(H,32,33) |
| InChIKey | RDTDGXFPRZNCAF-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 145.10 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.48 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|