C21H17FN2O4 — CID 25051400
2-amino-5-[[3-carboxy-4-(4-fluoroanilino)phenyl]methyl]benzoic acid (PubChem CID 25051400) has the molecular formula C21H17FN2O4 and a molecular weight of 380.38 g/mol. Its IUPAC name is 2-amino-5-[[3-carboxy-4-(4-fluoroanilino)phenyl]methyl]benzoic acid.
| Compound Name | 2-amino-5-[[3-carboxy-4-(4-fluoroanilino)phenyl]methyl]benzoic acid |
|---|---|
| PubChem CID | 25051400 |
| Molecular Formula | C21H17FN2O4 |
| Molecular Weight | 380.38 g/mol |
| Exact Mass | 380.12 |
| IUPAC Name | 2-amino-5-[[3-carboxy-4-(4-fluoroanilino)phenyl]methyl]benzoic acid |
| SMILES | Nc1ccc(Cc2ccc(Nc3ccc(F)cc3)c(C(=O)O)c2)cc1C(=O)O |
| InChI | InChI=1S/C21H17FN2O4/c22-14-3-5-15(6-4-14)24-19-8-2-13(11-17(19)21(27)28)9-12-1-7-18(23)16(10-12)20(25)26/h1-8,10-11,24H,9,23H2,(H,25,26)(H,27,28) |
| InChIKey | LVNOMPXHDGKWPZ-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 112.65 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.38 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|