C15H11ClO4S — CID 91878693
4-[4-(carboxymethyl)phenyl]sulfanyl-2-chlorobenzoic acid (PubChem CID 91878693) has the molecular formula C15H11ClO4S and a molecular weight of 322.77 g/mol. Its IUPAC name is 4-[4-(carboxymethyl)phenyl]sulfanyl-2-chlorobenzoic acid.
| Compound Name | 4-[4-(carboxymethyl)phenyl]sulfanyl-2-chlorobenzoic acid |
|---|---|
| PubChem CID | 91878693 |
| Molecular Formula | C15H11ClO4S |
| Molecular Weight | 322.77 g/mol |
| Exact Mass | 322.01 |
| IUPAC Name | 4-[4-(carboxymethyl)phenyl]sulfanyl-2-chlorobenzoic acid |
| SMILES | O=C(O)Cc1ccc(Sc2ccc(C(=O)O)c(Cl)c2)cc1 |
| InChI | InChI=1S/C15H11ClO4S/c16-13-8-11(5-6-12(13)15(19)20)21-10-3-1-9(2-4-10)7-14(17)18/h1-6,8H,7H2,(H,17,18)(H,19,20) |
| InChIKey | DHOZQWBPQFJYTJ-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.77 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |