C17H14O6S — CID 91878701
4-[4-(carboxymethyl)phenyl]sulfanyl-2-methoxycarbonylbenzoic acid (PubChem CID 91878701) has the molecular formula C17H14O6S and a molecular weight of 346.36 g/mol. Its IUPAC name is 4-[4-(carboxymethyl)phenyl]sulfanyl-2-methoxycarbonylbenzoic acid.
| Compound Name | 4-[4-(carboxymethyl)phenyl]sulfanyl-2-methoxycarbonylbenzoic acid |
|---|---|
| PubChem CID | 91878701 |
| Molecular Formula | C17H14O6S |
| Molecular Weight | 346.36 g/mol |
| Exact Mass | 346.05 |
| IUPAC Name | 4-[4-(carboxymethyl)phenyl]sulfanyl-2-methoxycarbonylbenzoic acid |
| SMILES | COC(=O)c1cc(Sc2ccc(CC(=O)O)cc2)ccc1C(=O)O |
| InChI | InChI=1S/C17H14O6S/c1-23-17(22)14-9-12(6-7-13(14)16(20)21)24-11-4-2-10(3-5-11)8-15(18)19/h2-7,9H,8H2,1H3,(H,18,19)(H,20,21) |
| InChIKey | AEGWDZYJPHATBY-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 100.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.36 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |