C18H18O5S — CID 91879262
2-[4-(4-ethoxycarbonyl-3-methoxyphenyl)sulfanylphenyl]acetic acid (PubChem CID 91879262) has the molecular formula C18H18O5S and a molecular weight of 346.40 g/mol. Its IUPAC name is 2-[4-(4-ethoxycarbonyl-3-methoxyphenyl)sulfanylphenyl]acetic acid.
| Compound Name | 2-[4-(4-ethoxycarbonyl-3-methoxyphenyl)sulfanylphenyl]acetic acid |
|---|---|
| PubChem CID | 91879262 |
| Molecular Formula | C18H18O5S |
| Molecular Weight | 346.40 g/mol |
| Exact Mass | 346.09 |
| IUPAC Name | 2-[4-(4-ethoxycarbonyl-3-methoxyphenyl)sulfanylphenyl]acetic acid |
| SMILES | CCOC(=O)c1ccc(Sc2ccc(CC(=O)O)cc2)cc1OC |
| InChI | InChI=1S/C18H18O5S/c1-3-23-18(21)15-9-8-14(11-16(15)22-2)24-13-6-4-12(5-7-13)10-17(19)20/h4-9,11H,3,10H2,1-2H3,(H,19,20) |
| InChIKey | HTUHAODZUGZTHJ-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.40 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |