C17H16O5S — CID 91879093
2-ethoxycarbonyl-5-(4-methoxyphenyl)sulfanylbenzoic acid (PubChem CID 91879093) has the molecular formula C17H16O5S and a molecular weight of 332.38 g/mol. Its IUPAC name is 2-ethoxycarbonyl-5-(4-methoxyphenyl)sulfanylbenzoic acid.
| Compound Name | 2-ethoxycarbonyl-5-(4-methoxyphenyl)sulfanylbenzoic acid |
|---|---|
| PubChem CID | 91879093 |
| Molecular Formula | C17H16O5S |
| Molecular Weight | 332.38 g/mol |
| Exact Mass | 332.07 |
| IUPAC Name | 2-ethoxycarbonyl-5-(4-methoxyphenyl)sulfanylbenzoic acid |
| SMILES | CCOC(=O)c1ccc(Sc2ccc(OC)cc2)cc1C(=O)O |
| InChI | InChI=1S/C17H16O5S/c1-3-22-17(20)14-9-8-13(10-15(14)16(18)19)23-12-6-4-11(21-2)5-7-12/h4-10H,3H2,1-2H3,(H,18,19) |
| InChIKey | CFHVOKYNSQLLGS-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.38 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |