C18H17BrO4S — CID 91877564
diethyl 4-(4-bromophenyl)sulfanylbenzene-1,2-dicarboxylate (PubChem CID 91877564) has the molecular formula C18H17BrO4S and a molecular weight of 409.30 g/mol. Its IUPAC name is diethyl 4-(4-bromophenyl)sulfanylbenzene-1,2-dicarboxylate.
| Compound Name | diethyl 4-(4-bromophenyl)sulfanylbenzene-1,2-dicarboxylate |
|---|---|
| PubChem CID | 91877564 |
| Molecular Formula | C18H17BrO4S |
| Molecular Weight | 409.30 g/mol |
| Exact Mass | 408.00 |
| IUPAC Name | diethyl 4-(4-bromophenyl)sulfanylbenzene-1,2-dicarboxylate |
| SMILES | CCOC(=O)c1ccc(Sc2ccc(Br)cc2)cc1C(=O)OCC |
| InChI | InChI=1S/C18H17BrO4S/c1-3-22-17(20)15-10-9-14(11-16(15)18(21)23-4-2)24-13-7-5-12(19)6-8-13/h5-11H,3-4H2,1-2H3 |
| InChIKey | GQAIPLNEDSTLLU-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.30 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |