C18H16O6S — CID 91879258
5-[4-(carboxymethyl)phenyl]sulfanyl-2-ethoxycarbonylbenzoic acid (PubChem CID 91879258) has the molecular formula C18H16O6S and a molecular weight of 360.39 g/mol. Its IUPAC name is 5-[4-(carboxymethyl)phenyl]sulfanyl-2-ethoxycarbonylbenzoic acid.
| Compound Name | 5-[4-(carboxymethyl)phenyl]sulfanyl-2-ethoxycarbonylbenzoic acid |
|---|---|
| PubChem CID | 91879258 |
| Molecular Formula | C18H16O6S |
| Molecular Weight | 360.39 g/mol |
| Exact Mass | 360.07 |
| IUPAC Name | 5-[4-(carboxymethyl)phenyl]sulfanyl-2-ethoxycarbonylbenzoic acid |
| SMILES | CCOC(=O)c1ccc(Sc2ccc(CC(=O)O)cc2)cc1C(=O)O |
| InChI | InChI=1S/C18H16O6S/c1-2-24-18(23)14-8-7-13(10-15(14)17(21)22)25-12-5-3-11(4-6-12)9-16(19)20/h3-8,10H,2,9H2,1H3,(H,19,20)(H,21,22) |
| InChIKey | CEEJZIRQDLQXAO-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 100.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.39 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |