C15H11IO4S — CID 91878004
5-[4-(carboxymethyl)phenyl]sulfanyl-2-iodobenzoic acid (PubChem CID 91878004) has the molecular formula C15H11IO4S and a molecular weight of 414.22 g/mol. Its IUPAC name is 5-[4-(carboxymethyl)phenyl]sulfanyl-2-iodobenzoic acid.
| Compound Name | 5-[4-(carboxymethyl)phenyl]sulfanyl-2-iodobenzoic acid |
|---|---|
| PubChem CID | 91878004 |
| Molecular Formula | C15H11IO4S |
| Molecular Weight | 414.22 g/mol |
| Exact Mass | 413.94 |
| IUPAC Name | 5-[4-(carboxymethyl)phenyl]sulfanyl-2-iodobenzoic acid |
| SMILES | O=C(O)Cc1ccc(Sc2ccc(I)c(C(=O)O)c2)cc1 |
| InChI | InChI=1S/C15H11IO4S/c16-13-6-5-11(8-12(13)15(19)20)21-10-3-1-9(2-4-10)7-14(17)18/h1-6,8H,7H2,(H,17,18)(H,19,20) |
| InChIKey | SKAUVUUOMAKQQC-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.22 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|