About 4-amino-2-chlorobenzoic acid;carbamic acid
4-amino-2-chlorobenzoic acid;carbamic acid (PubChem CID 67980253) has the molecular formula C8H9ClN2O4
and a molecular weight of 232.62 g/mol. Its IUPAC name is 4-amino-2-chlorobenzoic acid;carbamic acid.
Molecular Properties
| Compound Name | 4-amino-2-chlorobenzoic acid;carbamic acid |
| PubChem CID | 67980253 |
| Molecular Formula | C8H9ClN2O4 |
| Molecular Weight | 232.62 g/mol |
| Exact Mass | 232.03 |
| IUPAC Name | 4-amino-2-chlorobenzoic acid;carbamic acid |
| SMILES | NC(=O)O.Nc1ccc(C(=O)O)c(Cl)c1 |
| InChI | InChI=1S/C7H6ClNO2.CH3NO2/c8-6-3-4(9)1-2-5(6)7(10)11;2-1(3)4/h1-3H,9H2,(H,10,11);2H2,(H,3,4) |
| InChIKey | KLEZFTLQSZCCNR-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 126.64 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.62 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 4-amino-2-chlorobenzoic acid;carbamic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-amino-2-chlorobenzoic acid;carbamic acid?
The IUPAC name of 4-amino-2-chlorobenzoic acid;carbamic acid (CID 67980253) is 4-amino-2-chlorobenzoic acid;carbamic acid.
What is the SMILES notation for 4-amino-2-chlorobenzoic acid;carbamic acid?
The canonical SMILES for 4-amino-2-chlorobenzoic acid;carbamic acid is NC(=O)O.Nc1ccc(C(=O)O)c(Cl)c1.
What is the InChIKey of 4-amino-2-chlorobenzoic acid;carbamic acid?
The InChIKey is KLEZFTLQSZCCNR-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6ClNO2.CH3NO2/c8-6-3-4(9)1-2-5(6)7(10)11;2-1(3)4/h1-3H,9H2,(H,10,11);2H2,(H,3,4).
What are the key properties of 4-amino-2-chlorobenzoic acid;carbamic acid?
4-amino-2-chlorobenzoic acid;carbamic acid has a molecular weight of 232.62 g/mol, XLogP of 1.24, 1 rotatable bonds, 4 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-amino-2-chlorobenzoic acid;carbamic acid is sourced from PubChem (CID 67980253), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).