C11H13ClN4O3 — CID 62921855
4-amino-N,N-bis(2-amino-2-oxoethyl)-2-chlorobenzamide (PubChem CID 62921855) has the molecular formula C11H13ClN4O3 and a molecular weight of 284.70 g/mol. Its IUPAC name is 4-amino-N,N-bis(2-amino-2-oxoethyl)-2-chlorobenzamide.
| Compound Name | 4-amino-N,N-bis(2-amino-2-oxoethyl)-2-chlorobenzamide |
|---|---|
| PubChem CID | 62921855 |
| Molecular Formula | C11H13ClN4O3 |
| Molecular Weight | 284.70 g/mol |
| Exact Mass | 284.07 |
| IUPAC Name | 4-amino-N,N-bis(2-amino-2-oxoethyl)-2-chlorobenzamide |
| SMILES | NC(=O)CN(CC(N)=O)C(=O)c1ccc(N)cc1Cl |
| InChI | InChI=1S/C11H13ClN4O3/c12-8-3-6(13)1-2-7(8)11(19)16(4-9(14)17)5-10(15)18/h1-3H,4-5,13H2,(H2,14,17)(H2,15,18) |
| InChIKey | IPLWQYQPZQSFMR-UHFFFAOYSA-N |
| XLogP | -0.67 |
| TPSA | 132.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.70 |
| LogP ≤ 5 | -0.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|