C12H16N4O4 — CID 62921862
5-amino-N,N-bis(2-amino-2-oxoethyl)-2-methoxybenzamide (PubChem CID 62921862) has the molecular formula C12H16N4O4 and a molecular weight of 280.28 g/mol. Its IUPAC name is 5-amino-N,N-bis(2-amino-2-oxoethyl)-2-methoxybenzamide.
| Compound Name | 5-amino-N,N-bis(2-amino-2-oxoethyl)-2-methoxybenzamide |
|---|---|
| PubChem CID | 62921862 |
| Molecular Formula | C12H16N4O4 |
| Molecular Weight | 280.28 g/mol |
| Exact Mass | 280.12 |
| IUPAC Name | 5-amino-N,N-bis(2-amino-2-oxoethyl)-2-methoxybenzamide |
| SMILES | COc1ccc(N)cc1C(=O)N(CC(N)=O)CC(N)=O |
| InChI | InChI=1S/C12H16N4O4/c1-20-9-3-2-7(13)4-8(9)12(19)16(5-10(14)17)6-11(15)18/h2-4H,5-6,13H2,1H3,(H2,14,17)(H2,15,18) |
| InChIKey | OVBWUHLXKCWTDA-UHFFFAOYSA-N |
| XLogP | -1.31 |
| TPSA | 141.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.28 |
| LogP ≤ 5 | -1.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|