C11H13FN4O3 — CID 63110451
2-amino-N,N-bis(2-amino-2-oxoethyl)-4-fluorobenzamide (PubChem CID 63110451) has the molecular formula C11H13FN4O3 and a molecular weight of 268.25 g/mol. Its IUPAC name is 2-amino-N,N-bis(2-amino-2-oxoethyl)-4-fluorobenzamide.
| Compound Name | 2-amino-N,N-bis(2-amino-2-oxoethyl)-4-fluorobenzamide |
|---|---|
| PubChem CID | 63110451 |
| Molecular Formula | C11H13FN4O3 |
| Molecular Weight | 268.25 g/mol |
| Exact Mass | 268.10 |
| IUPAC Name | 2-amino-N,N-bis(2-amino-2-oxoethyl)-4-fluorobenzamide |
| SMILES | NC(=O)CN(CC(N)=O)C(=O)c1ccc(F)cc1N |
| InChI | InChI=1S/C11H13FN4O3/c12-6-1-2-7(8(13)3-6)11(19)16(4-9(14)17)5-10(15)18/h1-3H,4-5,13H2,(H2,14,17)(H2,15,18) |
| InChIKey | BECUTOMMVHQGOM-UHFFFAOYSA-N |
| XLogP | -1.18 |
| TPSA | 132.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.25 |
| LogP ≤ 5 | -1.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|