C11H11BrFN3O3 — CID 55156067
N,N-bis(2-amino-2-oxoethyl)-2-bromo-4-fluorobenzamide (PubChem CID 55156067) has the molecular formula C11H11BrFN3O3 and a molecular weight of 332.13 g/mol. Its IUPAC name is N,N-bis(2-amino-2-oxoethyl)-2-bromo-4-fluorobenzamide.
| Compound Name | N,N-bis(2-amino-2-oxoethyl)-2-bromo-4-fluorobenzamide |
|---|---|
| PubChem CID | 55156067 |
| Molecular Formula | C11H11BrFN3O3 |
| Molecular Weight | 332.13 g/mol |
| Exact Mass | 331.00 |
| IUPAC Name | N,N-bis(2-amino-2-oxoethyl)-2-bromo-4-fluorobenzamide |
| SMILES | NC(=O)CN(CC(N)=O)C(=O)c1ccc(F)cc1Br |
| InChI | InChI=1S/C11H11BrFN3O3/c12-8-3-6(13)1-2-7(8)11(19)16(4-9(14)17)5-10(15)18/h1-3H,4-5H2,(H2,14,17)(H2,15,18) |
| InChIKey | UVAXODKKTBLDLO-UHFFFAOYSA-N |
| XLogP | 0.00 |
| TPSA | 106.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.13 |
| LogP ≤ 5 | 0.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |