C11H10Br2F3NO — CID 107491527
2-bromo-N-(2-bromoethyl)-N-(2,2-difluoroethyl)-4-fluorobenzamide (PubChem CID 107491527) has the molecular formula C11H10Br2F3NO and a molecular weight of 389.01 g/mol. Its IUPAC name is 2-bromo-N-(2-bromoethyl)-N-(2,2-difluoroethyl)-4-fluorobenzamide.
| Compound Name | 2-bromo-N-(2-bromoethyl)-N-(2,2-difluoroethyl)-4-fluorobenzamide |
|---|---|
| PubChem CID | 107491527 |
| Molecular Formula | C11H10Br2F3NO |
| Molecular Weight | 389.01 g/mol |
| Exact Mass | 386.91 |
| IUPAC Name | 2-bromo-N-(2-bromoethyl)-N-(2,2-difluoroethyl)-4-fluorobenzamide |
| SMILES | O=C(c1ccc(F)cc1Br)N(CCBr)CC(F)F |
| InChI | InChI=1S/C11H10Br2F3NO/c12-3-4-17(6-10(15)16)11(18)8-2-1-7(14)5-9(8)13/h1-2,5,10H,3-4,6H2 |
| InChIKey | XMZDDSBHKXPWTJ-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.01 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|