C11H12BrF2NO3 — CID 107729136
N-(2-bromoethyl)-N-(2,2-difluoroethyl)-3,4-dihydroxybenzamide (PubChem CID 107729136) has the molecular formula C11H12BrF2NO3 and a molecular weight of 324.12 g/mol. Its IUPAC name is N-(2-bromoethyl)-N-(2,2-difluoroethyl)-3,4-dihydroxybenzamide.
| Compound Name | N-(2-bromoethyl)-N-(2,2-difluoroethyl)-3,4-dihydroxybenzamide |
|---|---|
| PubChem CID | 107729136 |
| Molecular Formula | C11H12BrF2NO3 |
| Molecular Weight | 324.12 g/mol |
| Exact Mass | 323.00 |
| IUPAC Name | N-(2-bromoethyl)-N-(2,2-difluoroethyl)-3,4-dihydroxybenzamide |
| SMILES | O=C(c1ccc(O)c(O)c1)N(CCBr)CC(F)F |
| InChI | InChI=1S/C11H12BrF2NO3/c12-3-4-15(6-10(13)14)11(18)7-1-2-8(16)9(17)5-7/h1-2,5,10,16-17H,3-4,6H2 |
| InChIKey | WEAPNRIWIAOFBH-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.12 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|