C12H13BrF2N2O4 — CID 107491672
N-(2-bromoethyl)-N-(2,2-difluoroethyl)-3-methoxy-4-nitrobenzamide (PubChem CID 107491672) has the molecular formula C12H13BrF2N2O4 and a molecular weight of 367.15 g/mol. Its IUPAC name is N-(2-bromoethyl)-N-(2,2-difluoroethyl)-3-methoxy-4-nitrobenzamide.
| Compound Name | N-(2-bromoethyl)-N-(2,2-difluoroethyl)-3-methoxy-4-nitrobenzamide |
|---|---|
| PubChem CID | 107491672 |
| Molecular Formula | C12H13BrF2N2O4 |
| Molecular Weight | 367.15 g/mol |
| Exact Mass | 366.00 |
| IUPAC Name | N-(2-bromoethyl)-N-(2,2-difluoroethyl)-3-methoxy-4-nitrobenzamide |
| SMILES | COc1cc(C(=O)N(CCBr)CC(F)F)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C12H13BrF2N2O4/c1-21-10-6-8(2-3-9(10)17(19)20)12(18)16(5-4-13)7-11(14)15/h2-3,6,11H,4-5,7H2,1H3 |
| InChIKey | PAVWRKHWQCYNCA-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 72.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.15 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|