C11H10BrClF2INO — CID 107491616
N-(2-bromoethyl)-3-chloro-N-(2,2-difluoroethyl)-4-iodobenzamide (PubChem CID 107491616) has the molecular formula C11H10BrClF2INO and a molecular weight of 452.46 g/mol. Its IUPAC name is N-(2-bromoethyl)-3-chloro-N-(2,2-difluoroethyl)-4-iodobenzamide.
| Compound Name | N-(2-bromoethyl)-3-chloro-N-(2,2-difluoroethyl)-4-iodobenzamide |
|---|---|
| PubChem CID | 107491616 |
| Molecular Formula | C11H10BrClF2INO |
| Molecular Weight | 452.46 g/mol |
| Exact Mass | 450.86 |
| IUPAC Name | N-(2-bromoethyl)-3-chloro-N-(2,2-difluoroethyl)-4-iodobenzamide |
| SMILES | O=C(c1ccc(I)c(Cl)c1)N(CCBr)CC(F)F |
| InChI | InChI=1S/C11H10BrClF2INO/c12-3-4-17(6-10(14)15)11(18)7-1-2-9(16)8(13)5-7/h1-2,5,10H,3-4,6H2 |
| InChIKey | MWGBCKYYCRJMLV-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.46 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|