C11H11Br2F2NO2 — CID 107491830
4-bromo-N-(2-bromoethyl)-N-(2,2-difluoroethyl)-2-hydroxybenzamide (PubChem CID 107491830) has the molecular formula C11H11Br2F2NO2 and a molecular weight of 387.02 g/mol. Its IUPAC name is 4-bromo-N-(2-bromoethyl)-N-(2,2-difluoroethyl)-2-hydroxybenzamide.
| Compound Name | 4-bromo-N-(2-bromoethyl)-N-(2,2-difluoroethyl)-2-hydroxybenzamide |
|---|---|
| PubChem CID | 107491830 |
| Molecular Formula | C11H11Br2F2NO2 |
| Molecular Weight | 387.02 g/mol |
| Exact Mass | 384.91 |
| IUPAC Name | 4-bromo-N-(2-bromoethyl)-N-(2,2-difluoroethyl)-2-hydroxybenzamide |
| SMILES | O=C(c1ccc(Br)cc1O)N(CCBr)CC(F)F |
| InChI | InChI=1S/C11H11Br2F2NO2/c12-3-4-16(6-10(14)15)11(18)8-2-1-7(13)5-9(8)17/h1-2,5,10,17H,3-4,6H2 |
| InChIKey | HAYFRTMXTQLMMT-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.02 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|