C12H14BrF2NO3 — CID 107491724
N-(2-bromoethyl)-N-(2,2-difluoroethyl)-2-hydroxy-3-methoxybenzamide (PubChem CID 107491724) has the molecular formula C12H14BrF2NO3 and a molecular weight of 338.15 g/mol. Its IUPAC name is N-(2-bromoethyl)-N-(2,2-difluoroethyl)-2-hydroxy-3-methoxybenzamide.
| Compound Name | N-(2-bromoethyl)-N-(2,2-difluoroethyl)-2-hydroxy-3-methoxybenzamide |
|---|---|
| PubChem CID | 107491724 |
| Molecular Formula | C12H14BrF2NO3 |
| Molecular Weight | 338.15 g/mol |
| Exact Mass | 337.01 |
| IUPAC Name | N-(2-bromoethyl)-N-(2,2-difluoroethyl)-2-hydroxy-3-methoxybenzamide |
| SMILES | COc1cccc(C(=O)N(CCBr)CC(F)F)c1O |
| InChI | InChI=1S/C12H14BrF2NO3/c1-19-9-4-2-3-8(11(9)17)12(18)16(6-5-13)7-10(14)15/h2-4,10,17H,5-7H2,1H3 |
| InChIKey | YKUDYPJKVMWHLK-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.15 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|