C13H18F2N2O2 — CID 107493431
N-(2-aminoethyl)-N-(2,2-difluoroethyl)-2-ethoxybenzamide (PubChem CID 107493431) has the molecular formula C13H18F2N2O2 and a molecular weight of 272.30 g/mol. Its IUPAC name is N-(2-aminoethyl)-N-(2,2-difluoroethyl)-2-ethoxybenzamide.
| Compound Name | N-(2-aminoethyl)-N-(2,2-difluoroethyl)-2-ethoxybenzamide |
|---|---|
| PubChem CID | 107493431 |
| Molecular Formula | C13H18F2N2O2 |
| Molecular Weight | 272.30 g/mol |
| Exact Mass | 272.13 |
| IUPAC Name | N-(2-aminoethyl)-N-(2,2-difluoroethyl)-2-ethoxybenzamide |
| SMILES | CCOc1ccccc1C(=O)N(CCN)CC(F)F |
| InChI | InChI=1S/C13H18F2N2O2/c1-2-19-11-6-4-3-5-10(11)13(18)17(8-7-16)9-12(14)15/h3-6,12H,2,7-9,16H2,1H3 |
| InChIKey | QFWCOLXZDZQHMH-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.30 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |