C13H16F3NO3 — CID 107483427
2-ethoxy-N-(2-hydroxyethyl)-N-(2,2,2-trifluoroethyl)benzamide (PubChem CID 107483427) has the molecular formula C13H16F3NO3 and a molecular weight of 291.27 g/mol. Its IUPAC name is 2-ethoxy-N-(2-hydroxyethyl)-N-(2,2,2-trifluoroethyl)benzamide.
| Compound Name | 2-ethoxy-N-(2-hydroxyethyl)-N-(2,2,2-trifluoroethyl)benzamide |
|---|---|
| PubChem CID | 107483427 |
| Molecular Formula | C13H16F3NO3 |
| Molecular Weight | 291.27 g/mol |
| Exact Mass | 291.11 |
| IUPAC Name | 2-ethoxy-N-(2-hydroxyethyl)-N-(2,2,2-trifluoroethyl)benzamide |
| SMILES | CCOc1ccccc1C(=O)N(CCO)CC(F)(F)F |
| InChI | InChI=1S/C13H16F3NO3/c1-2-20-11-6-4-3-5-10(11)12(19)17(7-8-18)9-13(14,15)16/h3-6,18H,2,7-9H2,1H3 |
| InChIKey | AGDVNKNNEUWUPB-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.27 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |