C12H15F2NO3 — CID 113462770
N-(2,2-difluoro-3-hydroxypropyl)-2-ethoxybenzamide (PubChem CID 113462770) has the molecular formula C12H15F2NO3 and a molecular weight of 259.25 g/mol. Its IUPAC name is N-(2,2-difluoro-3-hydroxypropyl)-2-ethoxybenzamide.
| Compound Name | N-(2,2-difluoro-3-hydroxypropyl)-2-ethoxybenzamide |
|---|---|
| PubChem CID | 113462770 |
| Molecular Formula | C12H15F2NO3 |
| Molecular Weight | 259.25 g/mol |
| Exact Mass | 259.10 |
| IUPAC Name | N-(2,2-difluoro-3-hydroxypropyl)-2-ethoxybenzamide |
| SMILES | CCOc1ccccc1C(=O)NCC(F)(F)CO |
| InChI | InChI=1S/C12H15F2NO3/c1-2-18-10-6-4-3-5-9(10)11(17)15-7-12(13,14)8-16/h3-6,16H,2,7-8H2,1H3,(H,15,17) |
| InChIKey | QELXZSRZJLVPQP-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.25 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |